What is the molecular formula of 17-Methyl-estra-3,5-diene-3,17beta-diol diacetate?
The molecular formula is C23H32O4.
What is the molecular weight of 17-Methyl-estra-3,5-diene-3,17beta-diol diacetate?
The molecular weight is 372.5 g/mol.
When was 17-Methyl-estra-3,5-diene-3,17beta-diol diacetate created?
It was created on October 28, 2017.
What is the canonical SMILES for 17-Methyl-estra-3,5-diene-3,17beta-diol diacetate?
The canonical SMILES is CC(=O)OC1=CC2=CCC3C(C2CC1)CCC4(C3CCC4(C)OC(=O)C)C.
How many Hydrogen Bond Acceptor Count does 17-Methyl-estra-3,5-diene-3,17beta-diol diacetate have?
It has 4 hydrogen bond acceptor counts.
What is the topological polar surface area of 17-Methyl-estra-3,5-diene-3,17beta-diol diacetate?
The topological polar surface area is 52.6 Å2.
Is 17-Methyl-estra-3,5-diene-3,17beta-diol diacetate a Covalently-Bonded Unit?
Yes, it is a covalently-bonded unit.
How many Defined Atom Stereocenter Counts does 17-Methyl-estra-3,5-diene-3,17beta-diol diacetate have?
It has 5 defined atom stereocenter counts.
What is the Exact Mass of 17-Methyl-estra-3,5-diene-3,17beta-diol diacetate?
The exact mass is 372.23005950 g/mol.
What is the IUPAC Name of 17-Methyl-estra-3,5-diene-3,17beta-diol diacetate?
The IUPAC name is [(8R,9R,10R,13S,14R)-17-acetyloxy-13,17-dimethyl-2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.