954235-93-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 2-(3-bromophenyl)-1,3-oxathiepane.
The molecular formula of the compound is C11H13BrOS.
The molecular weight of the compound is 273.19 g/mol.
The InChI of the compound is InChI=1S/C11H13BrOS/c12-10-5-3-4-9(8-10)11-13-6-1-2-7-14-11/h3-5,8,11H,1-2,6-7H2.
The InChIKey of the compound is MEBDFRNYMQMADD-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1CCSC(OC1)C2=CC(=CC=C2)Br.
The XLogP3-AA value of the compound is 3.5.
The compound has 0 hydrogen bond donor counts.
The compound has 2 hydrogen bond acceptor counts.
The compound has 1 rotatable bond count.