What is the molecular formula of 2-pyridin-2-ylpyrimidine-5-carbaldehyde?
The molecular formula is C10H7N3O.
When was 2-pyridin-2-ylpyrimidine-5-carbaldehyde created and last modified?
It was created on September 25, 2008, and last modified on December 30, 2023.
What is the IUPAC name of 2-pyridin-2-ylpyrimidine-5-carbaldehyde?
The IUPAC name is 2-pyridin-2-ylpyrimidine-5-carbaldehyde.
What is the InChI of 2-pyridin-2-ylpyrimidine-5-carbaldehyde?
The InChI is InChI=1S/C10H7N3O/c14-7-8-5-12-10(13-6-8)9-3-1-2-4-11-9/h1-7H.
What is the molecular weight of 2-pyridin-2-ylpyrimidine-5-carbaldehyde?
The molecular weight is 185.18 g/mol.
How many hydrogen bond acceptors does 2-pyridin-2-ylpyrimidine-5-carbaldehyde have?
It has 4 hydrogen bond acceptors.
What is the exact mass of 2-pyridin-2-ylpyrimidine-5-carbaldehyde?
The exact mass is 185.058911855 g/mol.
How many rotatable bonds does 2-pyridin-2-ylpyrimidine-5-carbaldehyde have?
It has 2 rotatable bonds.
Is 2-pyridin-2-ylpyrimidine-5-carbaldehyde a canonicalized compound?
Yes, it is a canonicalized compound.
What is the topological polar surface area of 2-pyridin-2-ylpyrimidine-5-carbaldehyde?
The topological polar surface area is 55.7 Å2.