What is the molecular formula of 1,3,4,7-Tetramethylpyrrolo[1,2-a]pyrazine?
The molecular formula of 1,3,4,7-Tetramethylpyrrolo[1,2-a]pyrazine is C11H14N2.
When was 1,3,4,7-Tetramethylpyrrolo[1,2-a]pyrazine created and modified in PubChem?
It was created on February 8, 2007, and last modified on December 30, 2023.
What is the IUPAC name of 1,3,4,7-Tetramethylpyrrolo[1,2-a]pyrazine?
The IUPAC name is 1,3,4,7-tetramethylpyrrolo[1,2-a]pyrazine.
What is the InChIKey for 1,3,4,7-Tetramethylpyrrolo[1,2-a]pyrazine?
The InChIKey is IGNRMBDEFGJQJE-UHFFFAOYSA-N.
What is the Canonical SMILES for 1,3,4,7-Tetramethylpyrrolo[1,2-a]pyrazine?
The Canonical SMILES is CC1=CN2C(=C(N=C(C2=C1)C)C).
What is the molecular weight of 1,3,4,7-Tetramethylpyrrolo[1,2-a]pyrazine?
The molecular weight is 174.24 g/mol.
How many hydrogen bond donor counts does 1,3,4,7-Tetramethylpyrrolo[1,2-a]pyrazine have?
It has 0 hydrogen bond donor count.
What is the XLogP3-AA value for 1,3,4,7-Tetramethylpyrrolo[1,2-a]pyrazine?
The XLogP3-AA value is 3.
What is the topological polar surface area of 1,3,4,7-Tetramethylpyrrolo[1,2-a]pyrazine?
The topological polar surface area is 17.3 Ų.
Is the compound Canonicalized according to PubChem?
Yes, the compound is canonicalized in PubChem.