What is the molecular formula of Benzene, 2,4-dichloro-1-[isocyano[(4-methylphenyl)sulfonyl]methyl]?
The molecular formula is C15H11Cl2NO2S.
When was Benzene, 2,4-dichloro-1-[isocyano[(4-methylphenyl)sulfonyl]methyl] created and last modified?
It was created on July 19, 2005, and last modified on December 30, 2023.
What is the IUPAC name of Benzene, 2,4-dichloro-1-[isocyano[(4-methylphenyl)sulfonyl]methyl]?
The IUPAC name is 2,4-dichloro-1-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene.
What is the molecular weight of Benzene, 2,4-dichloro-1-[isocyano[(4-methylphenyl)sulfonyl]methyl]?
The molecular weight is 340.2 g/mol.
What is the Canonical SMILES representation of Benzene, 2,4-dichloro-1-[isocyano[(4-methylphenyl)sulfonyl]methyl]?
The Canonical SMILES is CC1=CC=C(C=C1)S(=O)(=O)C(C2=C(C=C(C=C2)Cl)Cl)[N+]#[C-].
How many hydrogen bond acceptor counts does Benzene, 2,4-dichloro-1-[isocyano[(4-methylphenyl)sulfonyl]methyl] have?
It has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of Benzene, 2,4-dichloro-1-[isocyano[(4-methylphenyl)sulfonyl]methyl]?
The topological polar surface area is 46.9 Ų.
Does Benzene, 2,4-dichloro-1-[isocyano[(4-methylphenyl)sulfonyl]methyl] have any defined atom stereocenter counts?
No, it does not have any defined atom stereocenter counts.
How many rotatable bond counts does Benzene, 2,4-dichloro-1-[isocyano[(4-methylphenyl)sulfonyl]methyl] have?
It has 3 rotatable bond counts.
Is the compound Benzene, 2,4-dichloro-1-[isocyano[(4-methylphenyl)sulfonyl]methyl] canonicalized?
Yes, the compound is canonicalized.