What is the molecular formula of Methyl 2-tert-butyl-5-nitro-1H-indole-7-carboxylate?
The molecular formula is C14H16N2O4.
When was Methyl 2-tert-butyl-5-nitro-1H-indole-7-carboxylate created?
It was created on October 30, 2011.
What is the IUPAC name of Methyl 2-tert-butyl-5-nitro-1H-indole-7-carboxylate?
The IUPAC name is methyl 2-tert-butyl-5-nitro-1H-indole-7-carboxylate.
What is the InChI of Methyl 2-tert-butyl-5-nitro-1H-indole-7-carboxylate?
The InChI is InChI=1S/C14H16N2O4/c1-14(2,3)11-6-8-5-9(16(18)19)7-10(12(8)15-11)13(17)20-4/h5-7,15H,1-4H3.
What is the InChIKey of Methyl 2-tert-butyl-5-nitro-1H-indole-7-carboxylate?
The InChIKey is CAMMTUHPGSXTMO-UHFFFAOYSA-N.
What is the canonical SMILES of Methyl 2-tert-butyl-5-nitro-1H-indole-7-carboxylate?
The canonical SMILES is CC(C)(C)C1=CC2=CC(=CC(=C2N1)C(=O)OC)[N+](=O)[O-].
What is the CAS number of Methyl 2-tert-butyl-5-nitro-1H-indole-7-carboxylate?
The CAS number is 952665-00-8.
What is the molecular weight of Methyl 2-tert-butyl-5-nitro-1H-indole-7-carboxylate?
The molecular weight is 276.29 g/mol.
How many hydrogen bond donor count does Methyl 2-tert-butyl-5-nitro-1H-indole-7-carboxylate have?
It has 1 hydrogen bond donor count.
Is Methyl 2-tert-butyl-5-nitro-1H-indole-7-carboxylate a canonical compound?
Yes, it is a canonical compound.