What is the molecular formula of 4-(Trifluoromethyl)cyclohexanecarboxylic acid?
The molecular formula is C8H11F3O2.
When was 4-(Trifluoromethyl)cyclohexanecarboxylic acid created and modified?
It was created on 2005-07-19 and modified on 2023-12-30.
What are some synonyms for 4-(Trifluoromethyl)cyclohexanecarboxylic acid?
Some synonyms are cis-4-(Trifluoromethyl)cyclohexanecarboxylic Acid and trans-4-(Trifluoromethyl)cyclohexanecarboxylic Acid.
What is the molecular weight of 4-(Trifluoromethyl)cyclohexanecarboxylic acid?
The molecular weight is 196.17 g/mol.
What is the IUPAC name of 4-(Trifluoromethyl)cyclohexanecarboxylic acid?
The IUPAC name is 4-(trifluoromethyl)cyclohexane-1-carboxylic acid.
What is the InChIKey of 4-(Trifluoromethyl)cyclohexanecarboxylic acid?
The InChIKey is LMEAZIIFLVDISW-UHFFFAOYSA-N.
What is the Canonical SMILES representation of 4-(Trifluoromethyl)cyclohexanecarboxylic acid?
The Canonical SMILES is C1CC(CCC1C(=O)O)C(F)(F)F.
What is the CAS number for 4-(Trifluoromethyl)cyclohexanecarboxylic acid?
The CAS number is 95233-30-0.
How many hydrogen bond acceptors does 4-(Trifluoromethyl)cyclohexanecarboxylic acid have?
It has 5 hydrogen bond acceptors.
What is the topological polar surface area of 4-(Trifluoromethyl)cyclohexanecarboxylic acid?
The topological polar surface area is 37.3 Å2.