What is the molecular formula of Ethyl 2-(trifluoromethyl)quinoline-7-carboxylate?
The molecular formula is C13H10F3NO2.
What is the molecular weight of Ethyl 2-(trifluoromethyl)quinoline-7-carboxylate?
The molecular weight is 269.22 g/mol.
What is the IUPAC name of Ethyl 2-(trifluoromethyl)quinoline-7-carboxylate?
The IUPAC name is ethyl 2-(trifluoromethyl)quinoline-7-carboxylate.
What is the InChI of Ethyl 2-(trifluoromethyl)quinoline-7-carboxylate?
The InChI is InChI=1S/C13H10F3NO2/c1-2-19-12(18)9-4-3-8-5-6-11(13(14,15)16)17-10(8)7-9/h3-7H,2H2,1H3.
What is the Canonical SMILES of Ethyl 2-(trifluoromethyl)quinoline-7-carboxylate?
The Canonical SMILES is CCOC(=O)C1=CC2=C(C=C1)C=CC(=N2)C(F)(F)F.
When was Ethyl 2-(trifluoromethyl)quinoline-7-carboxylate first created in PubChem?
It was first created on 2010-03-29.
What is the XLogP3-AA value of Ethyl 2-(trifluoromethyl)quinoline-7-carboxylate?
The XLogP3-AA value is 3.3.
How many hydrogen bond acceptors does Ethyl 2-(trifluoromethyl)quinoline-7-carboxylate have?
It has 6 hydrogen bond acceptors.
What is the topological polar surface area of Ethyl 2-(trifluoromethyl)quinoline-7-carboxylate?
The topological polar surface area is 39.2 Å2.
Is Ethyl 2-(trifluoromethyl)quinoline-7-carboxylate a canonicalized compound in PubChem?
Yes, it is a canonicalized compound in PubChem.