What is the molecular formula of 2,3,5,6-Tetrabromo-4-methyl-4-nitro-2,5-cyclohexadien-1-one?
The molecular formula is C7H3Br4NO3.
What is the molecular weight of 2,3,5,6-Tetrabromo-4-methyl-4-nitro-2,5-cyclohexadien-1-one?
The molecular weight is 468.72 g/mol.
When was 2,3,5,6-Tetrabromo-4-methyl-4-nitro-2,5-cyclohexadien-1-one created?
It was created on July 19, 2005.
What is the InChI of 2,3,5,6-Tetrabromo-4-methyl-4-nitro-2,5-cyclohexadien-1-one?
The InChI is InChI=1S/C7H3Br4NO3/c1-7(12(14)15)5(10)2(8)4(13)3(9)6(7)11/h1H3.
How many hydrogen bond acceptor count does 2,3,5,6-Tetrabromo-4-methyl-4-nitro-2,5-cyclohexadien-1-one have?
It has 3 hydrogen bond acceptor count.
What is the topological polar surface area of 2,3,5,6-Tetrabromo-4-methyl-4-nitro-2,5-cyclohexadien-1-one?
The topological polar surface area is 62.9 Ų.
Is 2,3,5,6-Tetrabromo-4-methyl-4-nitro-2,5-cyclohexadien-1-one a canonicalized compound?
Yes, it is a canonicalized compound.
How many rotatable bond count does 2,3,5,6-Tetrabromo-4-methyl-4-nitro-2,5-cyclohexadien-1-one have?
It has 0 rotatable bond count.
What is the XLogP3-AA value of 2,3,5,6-Tetrabromo-4-methyl-4-nitro-2,5-cyclohexadien-1-one?
The XLogP3-AA value is 3.5.
How many heavy atoms are present in 2,3,5,6-Tetrabromo-4-methyl-4-nitro-2,5-cyclohexadien-1-one?
There are 15 heavy atoms present.