What is the molecular formula of (S)-(+)-4-(2,3-Epoxypropoxy)carbazole?
The molecular formula is C15H13NO2.
What is the molecular weight of (S)-(+)-4-(2,3-Epoxypropoxy)carbazole?
The molecular weight is 239.27 g/mol.
What is the IUPAC name of (S)-(+)-4-(2,3-Epoxypropoxy)carbazole?
The IUPAC name is 4-[[(2S)-oxiran-2-yl]methoxy]-9H-carbazole.
What is the InChI of (S)-(+)-4-(2,3-Epoxypropoxy)carbazole?
The InChI is InChI=1S/C15H13NO2/c1-2-5-12-11(4-1)15-13(16-12)6-3-7-14(15)18-9-10-8-17-10/h1-7,10,16H,8-9H2/t10-/m0/s1.
What is the InChIKey of (S)-(+)-4-(2,3-Epoxypropoxy)carbazole?
The InChIKey is SVWKIGRDISDRLO-JTQLQIEISA-N.
How many hydrogen bond donor counts does (S)-(+)-4-(2,3-Epoxypropoxy)carbazole have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of (S)-(+)-4-(2,3-Epoxypropoxy)carbazole?
The topological polar surface area is 37.6 Ų.
How many defined atom stereocenter counts does (S)-(+)-4-(2,3-Epoxypropoxy)carbazole have?
It has 1 defined atom stereocenter count.
Is (S)-(+)-4-(2,3-Epoxypropoxy)carbazole a canonicalized compound?
Yes, it is a canonicalized compound.
When was (S)-(+)-4-(2,3-Epoxypropoxy)carbazole last modified in the database?
It was last modified on 2023-12-30.