CAS
949495-68-5 Purity
---
949495-68-5 Purity
---
Shopping basket
2-Bromo-1-(5-chloropyridin-2-yl)ethanone
CAS
94952-47-3
Catalog Number
ACM94952473
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Bromo-1-(5-chloropyridin-2-yl)ethanone?
The molecular formula is C7H5BrClNO.
When was 2-Bromo-1-(5-chloropyridin-2-yl)ethanone first created in the database?
It was first created on October 26, 2006.
What is the IUPAC name of 2-Bromo-1-(5-chloropyridin-2-yl)ethanone?
The IUPAC name is 2-bromo-1-(5-chloropyridin-2-yl)ethanone.
What is the InChI of 2-Bromo-1-(5-chloropyridin-2-yl)ethanone?
The InChI is InChI=1S/C7H5BrClNO/c8-3-7(11)6-2-1-5(9)4-10-6/h1-2,4H,3H2.
What is the molecular weight of 2-Bromo-1-(5-chloropyridin-2-yl)ethanone?
The molecular weight is 234.48 g/mol.
How many hydrogen bond donor counts does 2-Bromo-1-(5-chloropyridin-2-yl)ethanone have?
It has 0 hydrogen bond donor counts.
What is the topological polar surface area of 2-Bromo-1-(5-chloropyridin-2-yl)ethanone?
The topological polar surface area is 30 angstrom squared.
Is the compound canonicalized?
Yes, the compound is canonicalized.
What is the exact mass and monoisotopic mass of 2-Bromo-1-(5-chloropyridin-2-yl)ethanone?
The exact mass and monoisotopic mass are both 232.92430 g/mol.
How many rotatable bond counts does 2-Bromo-1-(5-chloropyridin-2-yl)ethanone have?
It has 2 rotatable bond counts.
Recommended Products
CAS
94955-60-9 Purity
96%
94955-60-9 Purity
96%
![ACETAMIDE,N-[[4-(AMINOMETHYL)CYCLOHEXYL]METHYL]-](https://resource.alfa-chemistry.com/structure/949556-44-9.gif)
