What is the molecular formula of 2,3,4-Trichloro-6-(2,3,4,6-tetrachlorophenoxy)phenol?
The molecular formula is C12H3Cl7O2.
What is the PubChem CID of 2,3,4-Trichloro-6-(2,3,4,6-tetrachlorophenoxy)phenol?
The PubChem CID is 93509.
When was the compound created in PubChem?
The compound was created on August 8, 2005.
What is the IUPAC name of 2,3,4-Trichloro-6-(2,3,4,6-tetrachlorophenoxy)phenol?
The IUPAC name is 2,3,4-trichloro-6-(2,3,4,6-tetrachlorophenoxy)phenol.
What is the InChI of 2,3,4-Trichloro-6-(2,3,4,6-tetrachlorophenoxy)phenol?
The InChI is InChI=1S/C12H3Cl7O2/c13-3-1-5(15)12(10(19)8(3)17)21-6-2-4(14)7(16)9(18)11(6)20/h1-2,20H.
What is the InChIKey of 2,3,4-Trichloro-6-(2,3,4,6-tetrachlorophenoxy)phenol?
The InChIKey is IIGANKVUIOUWRI-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3,4-Trichloro-6-(2,3,4,6-tetrachlorophenoxy)phenol?
The canonical SMILES is C1=C(C(=C(C(=C1Cl)Cl)Cl)O)OC2=C(C(=C(C=C2Cl)Cl)Cl)Cl.
What is the CAS number of 2,3,4-Trichloro-6-(2,3,4,6-tetrachlorophenoxy)phenol?
The CAS number is 94888-12-7.
What is the molecular weight of 2,3,4-Trichloro-6-(2,3,4,6-tetrachlorophenoxy)phenol?
The molecular weight is 427.3 g/mol.
How many hydrogen bond acceptor counts does 2,3,4-Trichloro-6-(2,3,4,6-tetrachlorophenoxy)phenol have?
It has 2 hydrogen bond acceptor counts.