What is the molecular formula of 2,7-Diazaspiro[4.5]decane-2-carboxylic acid 1,1-dimethylethyl ester hydrochloride?
The molecular formula is C9H16N2O2.
What is the molecular weight of 2,7-Diazaspiro[4.5]decane-2-carboxylic acid 1,1-dimethylethyl ester hydrochloride?
The molecular weight is 184.24 g/mol.
What is the IUPAC name of 2,7-Diazaspiro[4.5]decane-2-carboxylic acid 1,1-dimethylethyl ester hydrochloride?
The IUPAC name is 2,9-diazaspiro[4.5]decane-2-carboxylic acid.
What is the InChi of 2,7-Diazaspiro[4.5]decane-2-carboxylic acid 1,1-dimethylethyl ester hydrochloride?
The InChi is InChI=1S/C9H16N2O2/c12-8(13)11-5-3-9(7-11)2-1-4-10-6-9/h10H,1-7H2,(H,12,13).
What is the InChIKey of 2,7-Diazaspiro[4.5]decane-2-carboxylic acid 1,1-dimethylethyl ester hydrochloride?
The InChIKey is SUUOTUHNULFDRE-UHFFFAOYSA-N.
What is the canonical SMILES of 2,7-Diazaspiro[4.5]decane-2-carboxylic acid 1,1-dimethylethyl ester hydrochloride?
The canonical SMILES is C1CC2(CCN(C2)C(=O)O)CNC1.
What is the XLogP3-AA value of 2,7-Diazaspiro[4.5]decane-2-carboxylic acid 1,1-dimethylethyl ester hydrochloride?
The XLogP3-AA value is -2.2.
How many hydrogen bond donor counts does 2,7-Diazaspiro[4.5]decane-2-carboxylic acid 1,1-dimethylethyl ester hydrochloride have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2,7-Diazaspiro[4.5]decane-2-carboxylic acid 1,1-dimethylethyl ester hydrochloride have?
It has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does 2,7-Diazaspiro[4.5]decane-2-carboxylic acid 1,1-dimethylethyl ester hydrochloride have?
It has 0 rotatable bond counts.