What is the molecular formula of 2-Cyclopropylamino-pyrimidine-4-carbaldehyde?
The molecular formula is C8H9N3O.
What is the molecular weight of 2-Cyclopropylamino-pyrimidine-4-carbaldehyde?
The molecular weight is 163.18 g/mol.
What is the IUPAC name of 2-Cyclopropylamino-pyrimidine-4-carbaldehyde?
The IUPAC name is 2-(cyclopropylamino)pyrimidine-4-carbaldehyde.
What is the InChI of 2-Cyclopropylamino-pyrimidine-4-carbaldehyde?
The InChI is InChI=1S/C8H9N3O/c12-5-7-3-4-9-8(11-7)10-6-1-2-6/h3-6H,1-2H2,(H,9,10,11).
What is the InChIKey of 2-Cyclopropylamino-pyrimidine-4-carbaldehyde?
The InChIKey is ZRJHVWLAGLLEAO-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Cyclopropylamino-pyrimidine-4-carbaldehyde?
The Canonical SMILES is C1CC1NC2=NC=CC(=N2)C=O.
What is the CAS number of 2-Cyclopropylamino-pyrimidine-4-carbaldehyde?
The CAS number is 948549-74-4.
How many hydrogen bond donor counts does 2-Cyclopropylamino-pyrimidine-4-carbaldehyde have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of 2-Cyclopropylamino-pyrimidine-4-carbaldehyde?
The topological polar surface area is 54.9 Ų.
Is the compound Canonicalized according to PubChem?
Yes, the compound is Canonicalized according to PubChem.