What is the molecular formula of the compound 2-Chloro-3-(3-chloropropyl)-7-fluoroquinoline?
The molecular formula is C12H10Cl2FN.
What is the molecular weight of 2-Chloro-3-(3-chloropropyl)-7-fluoroquinoline?
The molecular weight is 258.12 g/mol.
When was the compound 2-Chloro-3-(3-chloropropyl)-7-fluoroquinoline first created?
It was created on November 13, 2007.
What is the IUPAC name of 2-Chloro-3-(3-chloropropyl)-7-fluoroquinoline?
The IUPAC name is 2-chloro-3-(3-chloropropyl)-7-fluoroquinoline.
What is the InChI of 2-Chloro-3-(3-chloropropyl)-7-fluoroquinoline?
The InChI is InChI=1S/C12H10Cl2FN/c13-5-1-2-9-6-8-3-4-10(15)7-11(8)16-12(9)14/h3-4,6-7H,1-2,5H2.
How many hydrogen bond acceptor counts does 2-Chloro-3-(3-chloropropyl)-7-fluoroquinoline have?
It has 2 hydrogen bond acceptor counts.
What is the topological polar surface area value of 2-Chloro-3-(3-chloropropyl)-7-fluoroquinoline?
The value is 12.9 Ų.
Does 2-Chloro-3-(3-chloropropyl)-7-fluoroquinoline have any defined atom stereocenter counts?
No, it has 0 defined atom stereocenter counts.
How many rotatable bond counts does 2-Chloro-3-(3-chloropropyl)-7-fluoroquinoline have?
It has 3 rotatable bond counts.
Is 2-Chloro-3-(3-chloropropyl)-7-fluoroquinoline a canonical compound?
Yes, it is canonicalized according to PubChem.