What is the molecular formula of (S)-Methyl 6,6-dimethyl-morpholine-3-carboxylate?
The molecular formula is C8H15NO3.
What is the molecular weight of (S)-Methyl 6,6-dimethyl-morpholine-3-carboxylate?
The molecular weight is 173.21 g/mol.
What is the IUPAC name of (S)-Methyl 6,6-dimethyl-morpholine-3-carboxylate?
The IUPAC name is methyl (3S)-6,6-dimethylmorpholine-3-carboxylate.
What is the InChI of (S)-Methyl 6,6-dimethyl-morpholine-3-carboxylate?
The InChI is InChI=1S/C8H15NO3/c1-8(2)5-9-6(4-12-8)7(10)11-3/h6,9H,4-5H2,1-3H3/t6-/m0/s1.
What is the InChIKey of (S)-Methyl 6,6-dimethyl-morpholine-3-carboxylate?
The InChIKey is HIOMIOFBGFGDHW-LURJTMIESA-N.
What is the canonical SMILES of (S)-Methyl 6,6-dimethyl-morpholine-3-carboxylate?
The canonical SMILES is CC1(CNC(CO1)C(=O)OC).
What are the other synonyms of (S)-Methyl 6,6-dimethyl-morpholine-3-carboxylate?
The synonyms include 947729-86-4, (S)-METHYL 6,6-DIMETHYL-MORPHOLINE-3-CARBOXYLATE, (s)-methyl 6,6-dimethylmorpholine-3-carboxylate, etc.
What is the XLogP3-AA value of (S)-Methyl 6,6-dimethyl-morpholine-3-carboxylate?
The XLogP3-AA value is 0.
How many hydrogen bond donor counts does (S)-Methyl 6,6-dimethyl-morpholine-3-carboxylate have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does (S)-Methyl 6,6-dimethyl-morpholine-3-carboxylate have?
It has 4 hydrogen bond acceptor counts.