What is the molecular formula of Ethanone, 1-(4-ethyl-5-methoxy-2-nitrophenyl)?
The molecular formula is C11H13NO4.
What is the molecular weight of Ethanone, 1-(4-ethyl-5-methoxy-2-nitrophenyl)?
The molecular weight is 223.22 g/mol.
When was Ethanone, 1-(4-ethyl-5-methoxy-2-nitrophenyl) created?
It was created on October 30, 2011.
What is the IUPAC name of Ethanone, 1-(4-ethyl-5-methoxy-2-nitrophenyl)?
The IUPAC name is 1-(4-ethyl-5-methoxy-2-nitrophenyl)ethanone.
What is the InChI of Ethanone, 1-(4-ethyl-5-methoxy-2-nitrophenyl)?
The InChI is InChI=1S/C11H13NO4/c1-4-8-5-10(12(14)15)9(7(2)13)6-11(8)16-3/h5-6H,4H2,1-3H3.
What is the InChIKey of Ethanone, 1-(4-ethyl-5-methoxy-2-nitrophenyl)?
The InChIKey is LJVXEHAXEWSOKY-UHFFFAOYSA-N.
What is the canonical SMILES of Ethanone, 1-(4-ethyl-5-methoxy-2-nitrophenyl)?
The canonical SMILES is CCC1=CC(=C(C=C1OC)C(=O)C)[N+](=O)[O-].
What is the CAS number of Ethanone, 1-(4-ethyl-5-methoxy-2-nitrophenyl)?
The CAS number is 947691-66-9.
What is the XLogP3-AA value of Ethanone, 1-(4-ethyl-5-methoxy-2-nitrophenyl)?
The XLogP3-AA value is 2.2.
Is Ethanone, 1-(4-ethyl-5-methoxy-2-nitrophenyl) a canonicalized compound?
Yes, it is a canonicalized compound.