CAS
947533-49-5 Purity
---
947533-49-5 Purity
---
Inquiry Basket
4-(8-Bromo-imidazo[1,2-a]pyridin-2-yl)-benzoic acid methyl ester
CAS
947533-56-4
Catalog Number
ACM947533564
Category
Other Products
Molecular Weight
331.16404
Molecular Formula
C15H11BrN2O2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
4-(8-Bromo-imidazo[1,2-a]pyridin-2-yl)-benzoic acid methyl ester
What is the molecular formula of the compound?
The molecular formula is C15H11BrN2O2.
What is the synonym for the compound?
The synonym for the compound is 4-(8-Bromo-imidazo[1,2-a]pyridin-2-yl)-benzoic acid methyl ester.
What is the molecular weight of the compound?
The molecular weight of the compound is 331.16 g/mol.
When was the compound created and modified in PubChem?
The compound was created on April 27, 2010, and modified on December 30, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is methyl 4-(8-bromoimidazo[1,2-a]pyridin-2-yl)benzoate.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C15H11BrN2O2/c1-20-15(19)11-6-4-10(5-7-11)13-9-18-8-2-3-12(16)14(18)17-13/h2-9H,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is FFMOLIRVOKLOCG-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is COC(=O)C1=CC=C(C=C1)C2=CN3C=CC=C(C3=N2)Br.
What is the XLogP3-AA of the compound?
The XLogP3-AA of the compound is 4.
What is the hydrogen bond acceptor count of the compound?
The hydrogen bond acceptor count of the compound is 3.
Recommended Products
![8-Bromo-2-(4-nitro-phenyl)-imidazo[1,2-a]pyridine](https://resource.alfa-chemistry.com/structure/947533-49-5.gif)
![8-Bromo-2-(4-iodo-phenyl)-imidazo[1,2-a]pyridine](https://resource.alfa-chemistry.com/structure/947533-53-1.gif)
![7-Bromo-2-(4-fluoro-phenyl)-imidazo[1,2-a]pyridine](https://resource.alfa-chemistry.com/structure/947533-55-3.gif)
![7-Bromo-2-(4-iodo-phenyl)-imidazo[1,2-a]pyridine](https://resource.alfa-chemistry.com/structure/947533-58-6.gif)
![7-Bromo-2-(4-nitro-phenyl)-imidazo[1,2-a]pyridine](https://resource.alfa-chemistry.com/structure/947533-60-0.gif)
![4-(7-Bromo-imidazo[1,2-a]pyridin-2-yl)-benzoic acid methyl ester](https://resource.alfa-chemistry.com/structure/947533-62-2.gif)
CAS
947533-62-2 Purity
---
947533-62-2 Purity
---
