(R)-1-(2-Methoxy-benzenesulfonyl)-piperidin-3-ylamine hydrochloride

Name: (R)-1-(2-Methoxy-benzenesulfonyl)-piperidin-3-ylamine hydrochloride
SKU: ACM947532527
Rating: 5 (1 reviews)

CAS

947532-52-7

Catalog Number

ACM947532527

Category

Other Products

Molecular Weight

306.80886

Molecular Formula

C₁₂H₁₉ClN₂O₃S

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

(R)-1-(2-Methoxy-benzenesulfonyl)-piperidin-3-ylamine hydrochloride

What is the molecular formula of the compound?

The molecular formula of the compound is C12H19ClN2O3S.

What are the synonyms of the compound?

(R)-1-(2-METHOXY-BENZENESULFONYL)-PIPERIDIN-3-YLAMINE HYDROCHLORIDE, 947532-52-7, (3R)-1-(2-methoxyphenyl)sulfonylpiperidin-3-amine;hydrochloride, C12H19ClN2O3S, AKOS026338683.

What is the molecular weight of the compound?

The molecular weight of the compound is 306.81 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is (3R)-1-(2-methoxyphenyl)sulfonylpiperidin-3-amine;hydrochloride.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C12H18N2O3S.ClH/c1-17-11-6-2-3-7-12(11)18(15,16)14-8-4-5-10(13)9-14;/h2-3,6-7,10H,4-5,8-9,13H2,1H3;1H/t10-;/m1./s1.

What is the InChIKey of the compound?

The InChIKey of the compound is ULDHGPAQYMSYIO-HNCPQSOCSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is COC1=CC=CC=C1S(=O)(=O)N2CCCC(C2)N.Cl.

What is the isomeric SMILES of the compound?

The isomeric SMILES of the compound is COC1=CC=CC=C1S(=O)(=O)N2CCC[C@H](C2)N.Cl.

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count of the compound is 2.

What is the hydrogen bond acceptor count of the compound?

The hydrogen bond acceptor count of the compound is 5.

Recommended Products