What is the molecular formula of (R)-tert-Butyl 2-(2-hydroxyethyl)piperazine-1-carboxylate hydrochloride?
The molecular formula is C11H23ClN2O3.
What is the molecular weight of (R)-tert-Butyl 2-(2-hydroxyethyl)piperazine-1-carboxylate hydrochloride?
The molecular weight is 266.76 g/mol.
What are the synonyms for (R)-tert-Butyl 2-(2-hydroxyethyl)piperazine-1-carboxylate hydrochloride?
The synonyms include 947275-74-3, tert-Butyl (R)-2-(2-hydroxyethyl)piperazine-1-carboxylate hydrochloride, and 2103402-66-8.
When was (R)-tert-Butyl 2-(2-hydroxyethyl)piperazine-1-carboxylate hydrochloride created?
It was created on November 16, 2011.
What is the IUPAC name of (R)-tert-Butyl 2-(2-hydroxyethyl)piperazine-1-carboxylate hydrochloride?
The IUPAC name is tert-butyl (2R)-2-(2-hydroxyethyl)piperazine-1-carboxylate;hydrochloride.
What is the InChI key of (R)-tert-Butyl 2-(2-hydroxyethyl)piperazine-1-carboxylate hydrochloride?
The InChI key is IHAAIADIADPGMB-SBSPUUFOSA-N.
What is the canonical SMILES of (R)-tert-Butyl 2-(2-hydroxyethyl)piperazine-1-carboxylate hydrochloride?
The canonical SMILES is CC(C)(C)OC(=O)N1CCNCC1CCO.Cl.
How many hydrogen bond donor counts does (R)-tert-Butyl 2-(2-hydroxyethyl)piperazine-1-carboxylate hydrochloride have?
It has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does (R)-tert-Butyl 2-(2-hydroxyethyl)piperazine-1-carboxylate hydrochloride have?
It has 4 hydrogen bond acceptor counts.
Is (R)-tert-Butyl 2-(2-hydroxyethyl)piperazine-1-carboxylate hydrochloride a canonicalized compound?
Yes, it is a canonicalized compound.