What is the molecular formula of 3-Methyl-5-p-tolylthiophene-2-carboxylic acid?
The molecular formula is C13H12O2S.
What are the synonyms for 3-Methyl-5-p-tolylthiophene-2-carboxylic acid?
The synonyms are 3-methyl-5-p-tolylthiophene-2-carboxylic acid, 947149-26-0, SCHEMBL1021559, and QXPPXGFTRRTFFS-UHFFFAOYSA-N.
What is the molecular weight of 3-Methyl-5-p-tolylthiophene-2-carboxylic acid?
The molecular weight is 232.30 g/mol.
What is the IUPAC name of 3-Methyl-5-p-tolylthiophene-2-carboxylic acid?
The IUPAC name is 3-methyl-5-(4-methylphenyl)thiophene-2-carboxylic acid.
What is the InChI of 3-Methyl-5-p-tolylthiophene-2-carboxylic acid?
The InChI is InChI=1S/C13H12O2S/c1-8-3-5-10(6-4-8)11-7-9(2)12(16-11)13(14)15/h3-7H,1-2H3,(H,14,15).
What is the InChIKey of 3-Methyl-5-p-tolylthiophene-2-carboxylic acid?
The InChIKey is QXPPXGFTRRTFFS-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Methyl-5-p-tolylthiophene-2-carboxylic acid?
The canonical SMILES is CC1=CC=C(C=C1)C2=CC(=C(S2)C(=O)O).
What is the XLogP3-AA value of 3-Methyl-5-p-tolylthiophene-2-carboxylic acid?
The XLogP3-AA value is 3.9.
How many hydrogen bond donor counts does 3-Methyl-5-p-tolylthiophene-2-carboxylic acid have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 3-Methyl-5-p-tolylthiophene-2-carboxylic acid have?
It has 3 hydrogen bond acceptor counts.