946665-36-7 Purity
---
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C12H16O4.
The molecular weight of the compound is 224.25 g/mol.
The IUPAC name of the compound is 3-methoxy-4-(3-methoxypropoxy)benzaldehyde.
The Canonical SMILES representation of the compound is COCCCOC1=C(C=C(C=C1)C=O)OC.
The compound has 0 hydrogen bond donor counts.
The XLogP3-AA value of the compound is 1.5.
The compound has 4 hydrogen bond acceptor counts.
The compound has 7 rotatable bond counts.
The topological polar surface area of the compound is 44.8 Ų.
Yes, the compound is considered canonicalized.