CAS
946601-99-6 Purity
---
946601-99-6 Purity
---
Inquiry Basket
Pyrrolidine,2-(nitromethylene)-,(2Z)-(9ci)
CAS
94662-62-1
Catalog Number
ACM94662621
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is (2Z)-2-(nitromethylidene)pyrrolidine.
What is the molecular formula of the compound?
The molecular formula of the compound is C5H8N2O2.
What is the molecular weight of the compound?
The molecular weight of the compound is 128.13 g/mol.
When was the compound created?
The compound was created on September 15, 2005.
When was the compound last modified?
The compound was last modified on December 30, 2023.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C5H8N2O2/c8-7(9)4-5-2-1-3-6-5/h4,6H,1-3H2/b5-4-.
What is the InChIKey of the compound?
The InChIKey of the compound is LKMGDZMCCPSUFI-PLNGDYQASA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1CC(=C[N+](=O)[O-])NC1.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
Recommended Products
![2-Chloro-6-[2-(4-chlorophenyl)vinyl]nicotinonitrile](https://resource.alfa-chemistry.com/structure/946601-99-6.gif)
CAS
946610-68-0 Purity
---
946610-68-0 Purity
---
