What is the molecular formula of 6-Benzylsulfanyl-9-(2-methylpropyl)purin-2-amine according to the reference?
The molecular formula is C16H19N5S.
What is the molecular weight of 6-Benzylsulfanyl-9-(2-methylpropyl)purin-2-amine?
The molecular weight is 313.4 g/mol.
When was 6-Benzylsulfanyl-9-(2-methylpropyl)purin-2-amine created and modified in PubChem?
It was created on 2005-03-26 and modified on 2023-12-30.
What is the IUPAC name of 6-Benzylsulfanyl-9-(2-methylpropyl)purin-2-amine?
The IUPAC name is 6-benzylsulfanyl-9-(2-methylpropyl)purin-2-amine.
What is the InChI of 6-Benzylsulfanyl-9-(2-methylpropyl)purin-2-amine?
The InChI is InChI=1S/C16H19N5S/c1-11(2)8-21-10-18-13-14(21)19-16(17)20-15(13)22-9-12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3,(H2,17,19,20).
What is the InChIKey of 6-Benzylsulfanyl-9-(2-methylpropyl)purin-2-amine?
The InChIKey is NMYLQUCXBWTJHH-UHFFFAOYSA-N.
How many hydrogen bond acceptor counts does 6-Benzylsulfanyl-9-(2-methylpropyl)purin-2-amine have?
It has 5 hydrogen bond acceptor counts.
What is the topological polar surface area of 6-Benzylsulfanyl-9-(2-methylpropyl)purin-2-amine?
The topological polar surface area is 94.9 Ų.
Does 6-Benzylsulfanyl-9-(2-methylpropyl)purin-2-amine have any defined atom or bond stereocenter count?
No, it does not have any defined atom or bond stereocenter count.
Is the compound canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem.