What is the molecular formula of 2-(4-(tert-Butoxycarbonyl)phenyl)-2-fluoroacetic acid?
The molecular formula is C13H15FO4.
What are some synonyms for 2-(4-(tert-Butoxycarbonyl)phenyl)-2-fluoroacetic acid?
Some synonyms include 945610-03-7, 4-(Carboxy-fluoro-methyl)-benzoic acid tert-butyl ester, and SCHEMBL4303852.
What is the molecular weight of 2-(4-(tert-Butoxycarbonyl)phenyl)-2-fluoroacetic acid?
The molecular weight is 254.25 g/mol.
What is the IUPAC name of 2-(4-(tert-Butoxycarbonyl)phenyl)-2-fluoroacetic acid?
The IUPAC name is 2-fluoro-2-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]acetic acid.
What is the InChI of 2-(4-(tert-Butoxycarbonyl)phenyl)-2-fluoroacetic acid?
The InChI is InChI=1S/C13H15FO4/c1-13(2,3)18-12(17)9-6-4-8(5-7-9)10(14)11(15)16/h4-7,10H,1-3H3,(H,15,16).
What is the InChIKey of 2-(4-(tert-Butoxycarbonyl)phenyl)-2-fluoroacetic acid?
The InChIKey is VBJJVQLWCJAQDQ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-(4-(tert-Butoxycarbonyl)phenyl)-2-fluoroacetic acid?
The canonical SMILES is CC(C)(C)OC(=O)C1=CC=C(C=C1)C(C(=O)O)F.
What is the XLogP3-AA value of 2-(4-(tert-Butoxycarbonyl)phenyl)-2-fluoroacetic acid?
The XLogP3-AA value is 2.7.
How many hydrogen bond donor counts does 2-(4-(tert-Butoxycarbonyl)phenyl)-2-fluoroacetic acid have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-(4-(tert-Butoxycarbonyl)phenyl)-2-fluoroacetic acid have?
It has 5 hydrogen bond acceptor counts.