What is the molecular formula of 2-Chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine?
The molecular formula is C7H8ClN3.
When was 2-Chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine first created and modified on PubChem?
It was first created on December 5, 2007, and last modified on December 30, 2023.
What is the IUPAC name of 2-Chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine?
The IUPAC name is 2-chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine.
What is the InChI of 2-Chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine?
The InChI is InChI=1S/C7H8ClN3/c8-7-10-4-5-3-9-2-1-6(5)11-7/h4,9H,1-3H2.
What is the canonical SMILES of 2-Chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine?
The canonical SMILES is C1CNCC2=CN=C(N=C21)Cl.
What is the molecular weight of 2-Chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine?
The molecular weight is 169.61 g/mol.
How many hydrogen bond donor counts does 2-Chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of 2-Chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine?
The topological polar surface area is 37.8 Ų.
How many defined atom stereocenter counts does 2-Chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine have?
It has 0 defined atom stereocenter counts.
Is 2-Chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine a canonicalized compound?
Yes, it is a canonicalized compound.