What is the molecular formula of 3-Bromo-5,6,7,8-tetrahydro-imidazo[1,5-a]pyrazine?
The molecular formula is C6H8BrN3.
What is the molecular weight of 3-Bromo-5,6,7,8-tetrahydro-imidazo[1,5-a]pyrazine?
The molecular weight is 202.05 g/mol.
What is the IUPAC name of 3-Bromo-5,6,7,8-tetrahydro-imidazo[1,5-a]pyrazine?
The IUPAC name is 3-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine.
What is the InChI of 3-Bromo-5,6,7,8-tetrahydro-imidazo[1,5-a]pyrazine?
The InChI is InChI=1S/C6H8BrN3/c7-6-9-4-5-3-8-1-2-10(5)6/h4,8H,1-3H2.
What is the InChIKey of 3-Bromo-5,6,7,8-tetrahydro-imidazo[1,5-a]pyrazine?
The InChIKey is CRSLIIAXVGQLGJ-UHFFFAOYSA-N.
Does 3-Bromo-5,6,7,8-tetrahydro-imidazo[1,5-a]pyrazine have any synonyms?
Yes, some synonyms include 944900-87-2, 3-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine, and DTXSID50693608.
What is the XLogP3-AA value of 3-Bromo-5,6,7,8-tetrahydro-imidazo[1,5-a]pyrazine?
The XLogP3-AA value is 0.1.
How many hydrogen bond donor counts does 3-Bromo-5,6,7,8-tetrahydro-imidazo[1,5-a]pyrazine have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 3-Bromo-5,6,7,8-tetrahydro-imidazo[1,5-a]pyrazine have?
It has 2 hydrogen bond acceptor counts.
What is the topological polar surface area of 3-Bromo-5,6,7,8-tetrahydro-imidazo[1,5-a]pyrazine?
The topological polar surface area is 29.8 ?2.