What is the molecular formula of 4-Trimethylsilanyloxy-cyclohex-3-ene-carbaldehyde?
The molecular formula is C10H18O2Si.
What are some synonyms for 4-Trimethylsilanyloxy-cyclohex-3-ene-carbaldehyde?
Some synonyms include 94458-92-1, 4-[(Trimethylsilyl)oxy]cyclohex-3-ene-1-carbaldehyde, and 4-trimethylsilyloxycyclohex-3-ene-1-carbaldehyde.
When was 4-Trimethylsilanyloxy-cyclohex-3-ene-carbaldehyde created and modified in PubChem?
It was created on 2006-10-28 and modified on 2023-12-30.
What is the IUPAC Name of 4-Trimethylsilanyloxy-cyclohex-3-ene-carbaldehyde?
The IUPAC Name is 4-trimethylsilyloxycyclohex-3-ene-1-carbaldehyde.
What is the Canonical SMILES representation of 4-Trimethylsilanyloxy-cyclohex-3-ene-carbaldehyde?
The Canonical SMILES representation is C[Si](C)(C)OC1=CCC(CC1)C=O.
What is the InChIKey of 4-Trimethylsilanyloxy-cyclohex-3-ene-carbaldehyde?
The InChIKey is WVNCNMOJNGBSOP-UHFFFAOYSA-N.
What is the molecular weight of 4-Trimethylsilanyloxy-cyclohex-3-ene-carbaldehyde?
The molecular weight is 198.33 g/mol.
How many hydrogen bond acceptor counts does 4-Trimethylsilanyloxy-cyclohex-3-ene-carbaldehyde have?
It has 2 hydrogen bond acceptor counts.
What is the topological polar surface area of 4-Trimethylsilanyloxy-cyclohex-3-ene-carbaldehyde?
The topological polar surface area is 26.3 Ų.
Is 4-Trimethylsilanyloxy-cyclohex-3-ene-carbaldehyde considered canonicalized in PubChem?
Yes, it is considered canonicalized in PubChem.