CAS
944451-32-5 Purity
96%
944451-32-5 Purity
96%
![Chloro[(S)-(+)-5,5 -bis[di(3,5-di-tert-butyl-4-methoxyphenyl)phosphino]-4,4 -bi-1,3-benzodioxole](p-cymene)ruthenium(ii)chloride](https://resource.alfa-chemistry.com/structure/944451-33-6.gif)
![3-Pyridinecarbonitrile,5-[2-(2,3-dihydro-1,3-dioxo-1H-benz[de]isoquinolin-6-yl)diazenyl]-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-1-phenyl-](https://resource.alfa-chemistry.com/structure/944464-98-6.gif)
Inquiry Basket
2,5-ANHYDRO-1-AZIDO-1,3-DIDEOXY-3-(3,4-DIHYDRO-5-METHYL-2,4-DIOXO-1(2H)-PYRIMIDINYL)-L-MANNITOL
CAS
944475-10-9
Catalog Number
ACM944475109
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound with PubChem CID 90478099?
The molecular formula is C11H15N5O5.
What is the molecular weight of the compound?
The molecular weight is 297.27 g/mol.
What is the IUPAC name of the compound?
The IUPAC name is 1-[(2S,3R,4R,5S)-2-(azidomethyl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-5-methylpyrimidine-2,4-dione.
What is the canonical SMILES representation of the compound?
CC1=CN(C(=O)NC1=O)C2C(OC(C2O)CO)CN=[N+]=[N-]
How many hydrogen bond donor counts are there in the compound?
There are 3 hydrogen bond donor counts.
What is the hydrogen bond acceptor count for the compound?
The hydrogen bond acceptor count is 7.
What is the exact mass of the compound?
The exact mass is 297.10731860 g/mol.
What is the topological polar surface area of the compound?
The topological polar surface area is 114 Ų.
How many heavy atoms are present in the compound?
There are 21 heavy atoms in the compound.
Is the compound's defined atom stereocenter count 4?
Yes, the defined atom stereocenter count is 4.
Recommended Products
![Chloro{(R)-(-)-5,5-bis[di(3,5-di-t-butyl-4-methoxyphenyl)phosphino]-4,4-bi-1,3-benzodioxole}(p-cymene)ruthenium(ii)chloride[rucl(p-cymene)((R)-dtbm-segphos)]cl](https://resource.alfa-chemistry.com/structure/944451-32-5.gif)
CAS
944475-14-3 Purity
---
944475-14-3 Purity
---
