What is the molecular formula of tert-butyl 4-[4-(hydroxymethyl)pyrid-2-yl]piperazine-1-carboxylate?
The molecular formula is C15H23N3O3.
When was tert-butyl 4-[4-(hydroxymethyl)pyrid-2-yl]piperazine-1-carboxylate first created in PubChem?
It was first created on May 30, 2009.
What is the molecular weight of tert-butyl 4-[4-(hydroxymethyl)pyrid-2-yl]piperazine-1-carboxylate?
The molecular weight is 293.36 g/mol.
What is the IUPAC name of tert-butyl 4-[4-(hydroxymethyl)pyrid-2-yl]piperazine-1-carboxylate?
The IUPAC name is tert-butyl 4-[4-(hydroxymethyl)pyridin-2-yl]piperazine-1-carboxylate.
What is the InChIKey of tert-butyl 4-[4-(hydroxymethyl)pyrid-2-yl]piperazine-1-carboxylate?
The InChIKey is IIVNGRBJSABOQV-UHFFFAOYSA-N.
What is the Canonical SMILES of tert-butyl 4-[4-(hydroxymethyl)pyrid-2-yl]piperazine-1-carboxylate?
The Canonical SMILES is CC(C)(C)OC(=O)N1CCN(CC1)C2=NC=CC(=C2)CO.
How many hydrogen bond acceptor counts are there in tert-butyl 4-[4-(hydroxymethyl)pyrid-2-yl]piperazine-1-carboxylate?
There are 5 hydrogen bond acceptor counts.
What is the exact mass of tert-butyl 4-[4-(hydroxymethyl)pyrid-2-yl]piperazine-1-carboxylate?
The exact mass is 293.17394160 g/mol.
How many rotatable bond counts are there in tert-butyl 4-[4-(hydroxymethyl)pyrid-2-yl]piperazine-1-carboxylate?
There are 4 rotatable bond counts.
Is tert-butyl 4-[4-(hydroxymethyl)pyrid-2-yl]piperazine-1-carboxylate a canonicalized compound in PubChem?
Yes, it is a canonicalized compound in PubChem.