What is the molecular formula of Benzoic acid, 4-fluoro-, 1-methylhydrazide?
The molecular formula is C8H9FN2O.
What is the molecular weight of Benzoic acid, 4-fluoro-, 1-methylhydrazide?
The molecular weight is 168.17 g/mol.
What are some synonyms for Benzoic acid, 4-fluoro-, 1-methylhydrazide?
Some synonyms include 4-Fluoro-N-methylbenzohydrazide and 4-fluorobenzoic acid N-methyl hydrazine.
When was Benzoic acid, 4-fluoro-, 1-methylhydrazide first created in PubChem?
It was first created on March 29, 2010.
What is the IUPAC name of Benzoic acid, 4-fluoro-, 1-methylhydrazide?
The IUPAC name is 4-fluoro-N-methylbenzohydrazide.
What is the InChI of Benzoic acid, 4-fluoro-, 1-methylhydrazide?
The InChI is InChI=1S/C8H9FN2O/c1-11(10)8(12)6-2-4-7(9)5-3-6/h2-5H,10H2,1H3.
How many hydrogen bond acceptors does Benzoic acid, 4-fluoro-, 1-methylhydrazide have?
It has 3 hydrogen bond acceptors.
What is the topological polar surface area of Benzoic acid, 4-fluoro-, 1-methylhydrazide?
The topological polar surface area is 46.3 Å2.
Does Benzoic acid, 4-fluoro-, 1-methylhydrazide have any defined atom stereocenter count?
No, it has 0 defined atom stereocenter count.
Is the compound canonicalized for Benzoic acid, 4-fluoro-, 1-methylhydrazide?
Yes, the compound is canonicalized according to PubChem.