CAS
943751-93-7 Purity
---
943751-93-7 Purity
---
Inquiry Basket
Ethyl 2-(5-tert-butylthiophen-2-yl)acetate
CAS
943756-20-5
Catalog Number
ACM943756205
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of Ethyl 2-(5-tert-butylthiophen-2-yl)acetate?
The molecular formula of Ethyl 2-(5-tert-butylthiophen-2-yl)acetate is C12H18O2S.
What is the molecular weight of Ethyl 2-(5-tert-butylthiophen-2-yl)acetate?
The molecular weight of Ethyl 2-(5-tert-butylthiophen-2-yl)acetate is 226.34 g/mol.
What is the IUPAC name of Ethyl 2-(5-tert-butylthiophen-2-yl)acetate?
The IUPAC name of Ethyl 2-(5-tert-butylthiophen-2-yl)acetate is ethyl 2-(5-tert-butylthiophen-2-yl)acetate.
What is the InChI of Ethyl 2-(5-tert-butylthiophen-2-yl)acetate?
The InChI of Ethyl 2-(5-tert-butylthiophen-2-yl)acetate is InChI=1S/C12H18O2S/c1-5-14-11(13)8-9-6-7-10(15-9)12(2,3)4/h6-7H,5,8H2,1-4H3.
What is the InChIKey of Ethyl 2-(5-tert-butylthiophen-2-yl)acetate?
The InChIKey of Ethyl 2-(5-tert-butylthiophen-2-yl)acetate is DFWACDPQWYEFPR-UHFFFAOYSA-N.
What is the Canonical SMILES of Ethyl 2-(5-tert-butylthiophen-2-yl)acetate?
The Canonical SMILES of Ethyl 2-(5-tert-butylthiophen-2-yl)acetate is CCOC(=O)CC1=CC=C(S1)C(C)(C)C.
What is the XLogP3-AA value of Ethyl 2-(5-tert-butylthiophen-2-yl)acetate?
The XLogP3-AA value of Ethyl 2-(5-tert-butylthiophen-2-yl)acetate is 3.5.
How many hydrogen bond donor count does Ethyl 2-(5-tert-butylthiophen-2-yl)acetate have?
Ethyl 2-(5-tert-butylthiophen-2-yl)acetate has 0 hydrogen bond donor count.
How many hydrogen bond acceptor count does Ethyl 2-(5-tert-butylthiophen-2-yl)acetate have?
Ethyl 2-(5-tert-butylthiophen-2-yl)acetate has 3 hydrogen bond acceptor count.
How many rotatable bond count does Ethyl 2-(5-tert-butylthiophen-2-yl)acetate have?
Ethyl 2-(5-tert-butylthiophen-2-yl)acetate has 5 rotatable bond count.
Recommended Products
CAS
94375-42-5 Purity
---
94375-42-5 Purity
---
CAS
943758-92-7 Purity
---
943758-92-7 Purity
---
