CAS
94353-40-9 Purity
---
94353-40-9 Purity
---
Inquiry Basket
2-Bromophenyl boronic acid,N-methylcarboxy-N-methylglycinate
CAS
943552-28-1
Catalog Number
ACM943552281
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Bromophenyl boronic acid, N-methylcarboxy-N-methylglycinate?
The molecular formula is C11H15BBrNO6.
What is the molecular weight of 2-Bromophenyl boronic acid, N-methylcarboxy-N-methylglycinate?
The molecular weight is 347.96 g/mol.
What are the synonyms for 2-Bromophenyl boronic acid, N-methylcarboxy-N-methylglycinate?
The synonyms are 2-Bromophenyl boronic acid, N-methylcarboxy-N-methylglycinate.
What component compounds make up 2-Bromophenyl boronic acid, N-methylcarboxy-N-methylglycinate?
The component compounds are CID 2773294 (2-Bromophenylboronic acid) and CID 20441 (N-Methyliminodiacetic acid).
What is the IUPAC name of 2-Bromophenyl boronic acid, N-methylcarboxy-N-methylglycinate?
The IUPAC name is (2-bromophenyl)boronic acid;2-[carboxymethyl(methyl)amino]acetic acid.
What is the InChI of 2-Bromophenyl boronic acid, N-methylcarboxy-N-methylglycinate?
The InChI is InChI=1S/C6H6BBrO2.C5H9NO4/c8-6-4-2-1-3-5(6)7(9)10;1-6(2-4(7)8)3-5(9)10/h1-4,9-10H;2-3H2,1H3,(H,7,8)(H,9,10).
What is the InChIKey of 2-Bromophenyl boronic acid, N-methylcarboxy-N-methylglycinate?
The InChIKey is WVDIWTITJXUQCW-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromophenyl boronic acid, N-methylcarboxy-N-methylglycinate?
The canonical SMILES is B(C1=CC=CC=C1Br)(O)O.CN(CC(=O)O)CC(=O)O.
How many hydrogen bond donor counts does 2-Bromophenyl boronic acid, N-methylcarboxy-N-methylglycinate have?
It has 4 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Bromophenyl boronic acid, N-methylcarboxy-N-methylglycinate have?
It has 7 hydrogen bond acceptor counts.
Recommended Products
