What is the molecular formula of Methanone,phenyl[6-(sulfooxy)-2-naphthalenyl]-,potassium salt(1:1)?
The molecular formula is C17H11KO5S.
What is the molecular weight of Methanone,phenyl[6-(sulfooxy)-2-naphthalenyl]-,potassium salt(1:1)?
The molecular weight is 366.4 g/mol.
What are some synonyms of Methanone,phenyl[6-(sulfooxy)-2-naphthalenyl]-,potassium salt(1:1)?
Some synonyms include potassium 2-benzoyl-6-naphthyl sulphate, potassium salt, and 6-Benzoyl-2-naphthyl sulfate.
When was Methanone,phenyl[6-(sulfooxy)-2-naphthalenyl]-,potassium salt(1:1) created and last modified?
It was created on 2008-02-05 and last modified on 2023-12-30.
What is the IUPAC name of Methanone,phenyl[6-(sulfooxy)-2-naphthalenyl]-,potassium salt(1:1)?
The IUPAC name is potassium;(6-benzoylnaphthalen-2-yl) sulfate.
What is the Canonical SMILES of Methanone,phenyl[6-(sulfooxy)-2-naphthalenyl]-,potassium salt(1:1)?
The Canonical SMILES is C1=CC=C(C=C1)C(=O)C2=CC3=C(C=C2)C=C(C=C3)OS(=O)(=O)[O-].[K+].
What is the InChIKey of Methanone,phenyl[6-(sulfooxy)-2-naphthalenyl]-,potassium salt(1:1)?
The InChIKey is QDFLHEXSNOIYQU-UHFFFAOYSA-M.
What is the CAS number of Methanone,phenyl[6-(sulfooxy)-2-naphthalenyl]-,potassium salt(1:1)?
The CAS number is 94333-61-6.
What is the hydrogen bond donor count of Methanone,phenyl[6-(sulfooxy)-2-naphthalenyl]-,potassium salt(1:1)?
The hydrogen bond donor count is 0.
Is Methanone,phenyl[6-(sulfooxy)-2-naphthalenyl]-,potassium salt(1:1) a canonicalized compound?
Yes, the compound is canonicalized.