943320-68-1 Purity
96%
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C16H21BN2O4.
The IUPAC name of the compound is ethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-pyrrolo[2,3-b]pyridine-2-carboxylate.
The InChI of the compound is InChI=1S/C16H21BN2O4/c1-6-21-14(20)12-9-10-11(7-8-18-13(10)19-12)17-22-15(2,3)16(4,5)23-17/h7-8H,6,9H2,1-5H3.
The InChIKey of the compound is CKFCBRYXMSVNPY-UHFFFAOYSA-N.
The canonical SMILES of the compound is B1(OC(C(O1)(C)C)(C)C)C2=C3CC(=NC3=NC=C2)C(=O)OCC.
The molecular weight of the compound is 316.2 g/mol.
The compound has 0 hydrogen bond donor counts.
The compound has 6 hydrogen bond acceptor counts.
The compound has 4 rotatable bond counts.
Yes, the compound is canonicalized.