CAS
94291-49-3 Purity
---
94291-49-3 Purity
---
Inquiry Basket
2-[(3,3-Dimethylbicyclo[2.2.1]hept-2-yl)methyl]tetrahydrofuran
CAS
94291-53-9
Catalog Number
ACM94291539
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound with PubChem CID 44153081?
The molecular formula is C14H24O.
What is the molecular weight of the compound?
The molecular weight is 208.34 g/mol.
What is the IUPAC name of the compound?
The IUPAC name is 2-[(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]oxolane.
What is the InChI of the compound?
The InChI is InChI=1S/C14H24O/c1-14(2)11-6-5-10(8-11)13(14)9-12-4-3-7-15-12/h10-13H,3-9H2,1-2H3.
How many hydrogen bond donor counts does the compound have?
The compound has 0 hydrogen bond donor counts.
What is the topological polar surface area of the compound?
The topological polar surface area is 9.2 Å2.
How many heavy atoms are present in the compound?
There are 15 heavy atoms present in the compound.
Is the compound canonicalized?
Yes, the compound is canonicalized.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value is 4.1.
How many rotatable bond counts does the compound have?
The compound has 2 rotatable bond counts.
Recommended Products
![5-(3,3-Dimethylbicyclo[2.2.1]hept-2-ylidene)-3-methylpentan-2-ol](https://resource.alfa-chemistry.com/structure/94291-51-7.gif)
CAS
94291-51-7 Purity
---
94291-51-7 Purity
---
![4,4,6-Trimethyl-2-[1-methyl-2-[4-(1-methylethyl)phenyl]ethyl]-1,3-dioxane](https://resource.alfa-chemistry.com/structure/94291-56-2.gif)
CAS
94291-56-2 Purity
96%
94291-56-2 Purity
96%
