What is the molecular formula of Sodium 2-[3-(2-chlorophenyl)-1-methyltriazen-2-yl]ethanesulfonate?
The molecular formula is C9H12ClN3NaO3S+.
What is the molecular weight of Sodium 2-[3-(2-chlorophenyl)-1-methyltriazen-2-yl]ethanesulfonate?
The molecular weight is 300.72 g/mol.
When was Sodium 2-[3-(2-chlorophenyl)-1-methyltriazen-2-yl]ethanesulfonate created?
It was created on April 19, 2013.
When was Sodium 2-[3-(2-chlorophenyl)-1-methyltriazen-2-yl]ethanesulfonate last modified?
It was last modified on December 30, 2023.
What is the IUPAC name of Sodium 2-[3-(2-chlorophenyl)-1-methyltriazen-2-yl]ethanesulfonate?
The IUPAC name is sodium;2-[(2-chloroanilino)-methyliminoazaniumyl]ethanesulfonate.
What is the InChIKey of Sodium 2-[3-(2-chlorophenyl)-1-methyltriazen-2-yl]ethanesulfonate?
The InChIKey is XGKVTUJTQSAUBE-UHFFFAOYSA-N.
What is the Canonical SMILES of Sodium 2-[3-(2-chlorophenyl)-1-methyltriazen-2-yl]ethanesulfonate?
The Canonical SMILES is CN=[N+](CCS(=O)(=O)[O-])NC1=CC=CC=C1Cl.[Na+].
What is the CAS number of Sodium 2-[3-(2-chlorophenyl)-1-methyltriazen-2-yl]ethanesulfonate?
The CAS number is 94266-21-4.
What is the EC number of Sodium 2-[3-(2-chlorophenyl)-1-methyltriazen-2-yl]ethanesulfonate?
The EC number is 304-427-6.
What is the hydrogen bond donor count of Sodium 2-[3-(2-chlorophenyl)-1-methyltriazen-2-yl]ethanesulfonate?
The hydrogen bond donor count is 1.