What is the molecular formula of 2-Amino-4,7-difluorobenzothiazole?
The molecular formula is C7H4F2N2S.
When was 2-Amino-4,7-difluorobenzothiazole created in PubChem?
It was created on February 9, 2007.
What is the IUPAC name of 2-Amino-4,7-difluorobenzothiazole?
The IUPAC name is 4,7-difluoro-1,3-benzothiazol-2-amine.
What is the InChIKey of 2-Amino-4,7-difluorobenzothiazole?
The InChIKey is YKQBNWQKXODGRP-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino-4,7-difluorobenzothiazole?
The canonical SMILES is C1=CC(=C2C(=C1F)N=C(S2)N)F.
What is the molecular weight of 2-Amino-4,7-difluorobenzothiazole?
The molecular weight is 186.18 g/mol.
How many hydrogen bond donor counts does 2-Amino-4,7-difluorobenzothiazole have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of 2-Amino-4,7-difluorobenzothiazole?
The topological polar surface area is 67.2 Ų.
Does 2-Amino-4,7-difluorobenzothiazole have any defined atom stereocenter count?
No, it has 0 defined atom stereocenter count.
Is 2-Amino-4,7-difluorobenzothiazole considered as a canonicalized compound in PubChem?
Yes, it is considered as a canonicalized compound in PubChem.