94247-71-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of Diisobutylnaphthalene-2-sulfonic acid is C18H24O3S.
Some synonyms for Diisobutylnaphthalene-2-sulfonic acid are Diisobutylnaphthalene-2-sulphonic acid, 94247-75-3, and 6Z9PEP679S.
Diisobutylnaphthalene-2-sulfonic acid was created in PubChem on August 8, 2005.
The InChIKey of Diisobutylnaphthalene-2-sulfonic acid is UTDRFZYLWMKWGN-UHFFFAOYSA-N.
Yes, Diisobutylnaphthalene-2-sulfonic acid has a hydrogen bond acceptor count of 3.
The topological polar surface area of Diisobutylnaphthalene-2-sulfonic acid is 62.8 Å2.
Diisobutylnaphthalene-2-sulfonic acid has a rotatable bond count of 5.
The molecular weight of Diisobutylnaphthalene-2-sulfonic acid is 320.4 g/mol.
The Canonical SMILES representation of Diisobutylnaphthalene-2-sulfonic acid is CC(C)CC1=CC2=CC=CC=C2C(=C1S(=O)(=O)O)CC(C)C.
Yes, Diisobutylnaphthalene-2-sulfonic acid is canonicalized in PubChem.