What is the molecular formula of 1-(3-Hydroxyphenyl)-2-(methylamino)ethanone hydrochloride?
The molecular formula is C9H12ClNO2.
What is the molecular weight of 1-(3-Hydroxyphenyl)-2-(methylamino)ethanone hydrochloride?
The molecular weight is 201.65 g/mol.
What are some synonyms for 1-(3-Hydroxyphenyl)-2-(methylamino)ethanone hydrochloride?
Some synonyms include Phenylephrone Hydrochloride and 1-(3-hydroxyphenyl)-2-(methylamino)ethanone.
What is the IUPAC name of 1-(3-Hydroxyphenyl)-2-(methylamino)ethanone hydrochloride?
The IUPAC name is 1-(3-hydroxyphenyl)-2-(methylamino)ethanone; hydrochloride.
What is the InChI key for 1-(3-Hydroxyphenyl)-2-(methylamino)ethanone hydrochloride?
The InChI key is DEOGEZWYKPQJLP-UHFFFAOYSA-N.
What is the canonical SMILES representation of 1-(3-Hydroxyphenyl)-2-(methylamino)ethanone hydrochloride?
The canonical SMILES representation is CNCC(=O)C1=CC(=CC=C1)O.Cl.
What is the CAS number for 1-(3-Hydroxyphenyl)-2-(methylamino)ethanone hydrochloride?
The CAS number is 94240-17-2.
How many hydrogen bond donor counts does 1-(3-Hydroxyphenyl)-2-(methylamino)ethanone hydrochloride have?
It has 3 hydrogen bond donor counts.
What is the topological polar surface area of 1-(3-Hydroxyphenyl)-2-(methylamino)ethanone hydrochloride?
The topological polar surface area is 49.3Å^2.
Is 1-(3-Hydroxyphenyl)-2-(methylamino)ethanone hydrochloride a canonicalized compound?
Yes, it is a canonicalized compound.