What is the molecular formula of 4,6-Dihydro-9-methoxy-1,2,5-trimethyl-3H-pyrido[4,3-b]carbazolium chloride?
The molecular formula is C19H23ClN2O.
When was 4,6-Dihydro-9-methoxy-1,2,5-trimethyl-3H-pyrido[4,3-b]carbazolium chloride created?
It was created on August 20, 2009.
What is the molecular weight of 4,6-Dihydro-9-methoxy-1,2,5-trimethyl-3H-pyrido[4,3-b]carbazolium chloride?
The molecular weight is 330.8 g/mol.
What is the InChIKey of 4,6-Dihydro-9-methoxy-1,2,5-trimethyl-3H-pyrido[4,3-b]carbazolium chloride?
The InChIKey is UXFMXBVMFYZYOA-UHFFFAOYSA-N.
What is the Canonical SMILES of 4,6-Dihydro-9-methoxy-1,2,5-trimethyl-3H-pyrido[4,3-b]carbazolium chloride?
The Canonical SMILES is CC1=C2CCN(C(=C2C=C3C1[NH2+]C4=C3C=C(C=C4)OC)C)[Cl-].
How many hydrogen bond donor counts does 4,6-Dihydro-9-methoxy-1,2,5-trimethyl-3H-pyrido[4,3-b]carbazolium chloride have?
It has 1 hydrogen bond donor count.
What is the heavy atom count in 4,6-Dihydro-9-methoxy-1,2,5-trimethyl-3H-pyrido[4,3-b]carbazolium chloride?
The heavy atom count is 23.
Does 4,6-Dihydro-9-methoxy-1,2,5-trimethyl-3H-pyrido[4,3-b]carbazolium chloride have any defined atom stereocenter count?
It does not have any defined atom stereocenter count.
What is the topological polar surface area of 4,6-Dihydro-9-methoxy-1,2,5-trimethyl-3H-pyrido[4,3-b]carbazolium chloride?
The topological polar surface area is 29.1 Ų.
Is 4,6-Dihydro-9-methoxy-1,2,5-trimethyl-3H-pyrido[4,3-b]carbazolium chloride a canonicalized compound?
Yes, it is a canonicalized compound.