CAS
942436-10-4 Purity
---
942436-10-4 Purity
---
![Sodium bis[n-(2-chlorophenyl)-2-[[2-hydroxy-5-mesylphenyl]azo]-3-oxobutyramidato(2-)]cobaltate(1-)](https://resource.alfa-chemistry.com/structure/94246-68-1.gif)
![Sodium bis[7-amino-8-[(2-hydroxy-4-Nitrophenyl)azo]-n-methylnaphthalene-2-sulfonamidato(2-)]cobaltate(1-)](https://resource.alfa-chemistry.com/structure/94246-71-6.gif)
Inquiry Basket
(1-Hydroxy-1-phenylpropan-2-yl)dimethylazanium chloride
CAS
942-46-1
Catalog Number
ACM942461
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
(1-Hydroxy-1-phenylpropan-2-yl)dimethylazanium chloride;DL-Methylephedrine hydrochloride
What is the molecular formula of the compound with PubChem CID 22218819?
The molecular formula is C11H18ClNO.
When was the compound created in PubChem?
The compound was created on December 5, 2007.
What is the IUPAC name of the compound?
The IUPAC name is 1-methoxy-N-methyl-1-phenylpropan-2-amine hydrochloride.
What is the Canonical SMILES of the compound?
The Canonical SMILES is CC(C(C1=CC=CC=C1)OC)NC.Cl.
What is the molecular weight of the compound?
The molecular weight is 215.72 g/mol.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
What is the exact mass of the compound?
The exact mass is 215.1076919 g/mol.
How many hydrogen bond acceptor counts does the compound have?
The compound has 2 hydrogen bond acceptor counts.
What is the topological polar surface area of the compound?
The topological polar surface area is 21.3 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
![Pyrrolo[4,3,2-de]quinolin-8(1H)-one,7-(ethylamino)-3,4-dihydro-](https://resource.alfa-chemistry.com/structure/942436-10-4.gif)
CAS
94246-72-7 Purity
96%
94246-72-7 Purity
96%
