What is the molecular formula of Sodium 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]toluene-3-sulfonate?
The molecular formula is C10H7Cl2N4NaO3S.
When was Sodium 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]toluene-3-sulfonate created?
It was created on February 5, 2008.
What is the molecular weight of Sodium 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]toluene-3-sulfonate?
The molecular weight is 357.15 g/mol.
What is the IUPAC name of Sodium 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]toluene-3-sulfonate?
The IUPAC name is sodium;2-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-methylbenzenesulfonate.
What is the InChIKey of Sodium 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]toluene-3-sulfonate?
The InChIKey is FWMYYRQSLCZOOL-UHFFFAOYSA-M.
What is the canonical SMILES representation of Sodium 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]toluene-3-sulfonate?
The canonical SMILES is CC1=CC(=C(C=C1)NC2=NC(=NC(=N2)Cl)Cl)S(=O)(=O)[O-].[Na+].
How many hydrogen bond donor counts does Sodium 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]toluene-3-sulfonate have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of Sodium 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]toluene-3-sulfonate?
The topological polar surface area is 116 Å2.
How many rotatable bond counts does Sodium 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]toluene-3-sulfonate have?
It has 3 rotatable bond counts.
What is the exact mass of Sodium 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]toluene-3-sulfonate?
The exact mass is 355.9513609 g/mol.