What is the molecular formula of (2,3-Dihydroxypropyl)hydrogen succinate?
The molecular formula is C7H12O6.
What is the molecular weight of (2,3-Dihydroxypropyl)hydrogen succinate?
The molecular weight is 192.17 g/mol.
When was (2,3-Dihydroxypropyl)hydrogen succinate created in PubChem?
It was created on October 25, 2006.
What is the IUPAC name of (2,3-Dihydroxypropyl)hydrogen succinate?
The IUPAC name is 4-(2,3-dihydroxypropoxy)-4-oxobutanoic acid.
What is the InChI of (2,3-Dihydroxypropyl)hydrogen succinate?
The InChI is InChI=1S/C7H12O6/c8-3-5(9)4-13-7(12)2-1-6(10)11/h5,8-9H,1-4H2,(H,10,11).
What is the InChIKey of (2,3-Dihydroxypropyl)hydrogen succinate?
The InChIKey is DQHHKFVACXSZHQ-UHFFFAOYSA-N.
What is the canonical SMILES of (2,3-Dihydroxypropyl)hydrogen succinate?
The canonical SMILES is C(CC(=O)OCC(CO)O)C(=O)O.
What is the CAS number of (2,3-Dihydroxypropyl)hydrogen succinate?
The CAS number is 94199-49-2.
What is the European Community (EC) number of (2,3-Dihydroxypropyl)hydrogen succinate?
The European Community (EC) number is 303-422-6.
What is the XLogP3 value of (2,3-Dihydroxypropyl)hydrogen succinate?
The XLogP3 value is -1.6.