94191-15-8 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C12H12N2O3.
The molecular weight is 232.23 g/mol.
The IUPAC name is 3-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid.
The Canonical SMILES is CC1=CC=CC=C1C2=NOC(=N2)CCC(=O)O.
The compound has 1 hydrogen bond donor count.
The compound has 5 hydrogen bond acceptor counts.
The topological polar surface area is 76.2?2.
The compound has 4 rotatable bond counts.
Yes, the compound is canonicalized.
The exact mass is 232.08479225 g/mol.