What is the molecular formula of Benzoic acid, 3,5-bis(1-methylethoxy)-, methyl ester?
Molecular formula: C14H20O4
When was Benzoic acid, 3,5-bis(1-methylethoxy)-, methyl ester created according to PubChem?
Created on: 2009-05-28
What is the IUPAC name of Benzoic acid, 3,5-bis(1-methylethoxy)-, methyl ester?
IUPAC Name: methyl 3,5-di(propan-2-yloxy)benzoate
What is the molecular weight of Benzoic acid, 3,5-bis(1-methylethoxy)-, methyl ester?
Molecular Weight: 252.31 g/mol
What is the Canonical SMILES of Benzoic acid, 3,5-bis(1-methylethoxy)-, methyl ester?
Canonical SMILES: CC(C)OC1=CC(=CC(=C1)C(=O)OC)OC(C)C
What is the InChIKey of Benzoic acid, 3,5-bis(1-methylethoxy)-, methyl ester?
InChIKey: IENVJGGBZFULPX-UHFFFAOYSA-N
What is the CAS identifier for Benzoic acid, 3,5-bis(1-methylethoxy)-, methyl ester?
CAS: 94169-62-7
What is the XLogP3 value of Benzoic acid, 3,5-bis(1-methylethoxy)-, methyl ester?
XLogP3 value: 3.7
How many hydrogen bond acceptor counts does Benzoic acid, 3,5-bis(1-methylethoxy)-, methyl ester have?
Hydrogen Bond Acceptor Count: 4
Is the compound of Benzoic acid, 3,5-bis(1-methylethoxy)-, methyl ester canonicalized?
Compound Is Canonicalized: Yes