What is the molecular formula of N-[2-[(2-Hydroxyethyl)amino]ethyl]myristamide monoacetate?
The molecular formula is C20H40N2O3.
What is the molecular weight of N-[2-[(2-Hydroxyethyl)amino]ethyl]myristamide monoacetate?
The molecular weight is 356.5 g/mol.
When was N-[2-[(2-Hydroxyethyl)amino]ethyl]myristamide monoacetate created in PubChem?
It was created on August 20, 2009.
What is the InChI of N-[2-[(2-Hydroxyethyl)amino]ethyl]myristamide monoacetate?
The InChI is InChI=1S/C20H40N2O3/c1-4-6-7-8-9-10-11-12-13-14-15-16-20(24)22(25-19(3)23)18-17-21-5-2/h21H,4-18H2,1-3H3.
What is the InChIKey of N-[2-[(2-Hydroxyethyl)amino]ethyl]myristamide monoacetate?
The InChIKey is DMPCVHZWDRNIHS-UHFFFAOYSA-N.
How many hydrogen bond donor counts are there in N-[2-[(2-Hydroxyethyl)amino]ethyl]myristamide monoacetate?
There is one hydrogen bond donor count.
What is the XLogP3-AA value for N-[2-[(2-Hydroxyethyl)amino]ethyl]myristamide monoacetate?
The XLogP3-AA value is 6.
How many rotatable bond counts are there in N-[2-[(2-Hydroxyethyl)amino]ethyl]myristamide monoacetate?
There are 18 rotatable bond counts.
What is the topological polar surface area of N-[2-[(2-Hydroxyethyl)amino]ethyl]myristamide monoacetate?
The topological polar surface area is 58.6 Ų.
Is the compound canonicalized for N-[2-[(2-Hydroxyethyl)amino]ethyl]myristamide monoacetate?
Yes, the compound is canonicalized.