What is the molecular formula of lithium (9Z,12Z,15Z)-9,12,15-octadecatrienoate?
The molecular formula is C18H29LiO2.
When was lithium (9Z,12Z,15Z)-9,12,15-octadecatrienoate first created in the database?
It was first created on February 5, 2008.
What is the molecular weight of lithium (9Z,12Z,15Z)-9,12,15-octadecatrienoate?
The molecular weight is 284.4 g/mol.
What is the IUPAC name of lithium (9Z,12Z,15Z)-9,12,15-octadecatrienoate?
The IUPAC name is lithium;(9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
What is the Canonical SMILES representation of lithium (9Z,12Z,15Z)-9,12,15-octadecatrienoate?
The Canonical SMILES is [Li+].CCC=CCC=CCC=CCCCCCCCC(=O)[O-].
What is the InChIKey of lithium (9Z,12Z,15Z)-9,12,15-octadecatrienoate?
The InChIKey is DYWHQKKVLYASPF-IFNWOZJISA-M.
How many hydrogen bond acceptor counts does lithium (9Z,12Z,15Z)-9,12,15-octadecatrienoate have?
It has 2 hydrogen bond acceptor counts.
What is the topological polar surface area of lithium (9Z,12Z,15Z)-9,12,15-octadecatrienoate?
The topological polar surface area is 40.1 Å2.
How many rotatable bond counts does lithium (9Z,12Z,15Z)-9,12,15-octadecatrienoate have?
It has 13 rotatable bond counts.
Is the compound canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem.