What is the molecular formula of Potassium 6-[methyl(phenylsulfonyl)amino]hexanoate?
The molecular formula is C13H18KNO4S.
When was Potassium 6-[methyl(phenylsulfonyl)amino]hexanoate created and last modified?
It was created on 2008-02-05 and last modified on 2023-12-30.
What is the IUPAC name of Potassium 6-[methyl(phenylsulfonyl)amino]hexanoate?
The IUPAC name is potassium;6-[benzenesulfonyl(methyl)amino]hexanoate.
What is the InChIKey of Potassium 6-[methyl(phenylsulfonyl)amino]hexanoate?
The InChIKey is CTWVOIURYAXYBM-UHFFFAOYSA-M.
What is the Canonical SMILES of Potassium 6-[methyl(phenylsulfonyl)amino]hexanoate?
The Canonical SMILES is CN(CCCCCC(=O)[O-])S(=O)(=O)C1=CC=CC=C1.[K+].
What is the molecular weight of Potassium 6-[methyl(phenylsulfonyl)amino]hexanoate?
The molecular weight is 323.45 g/mol.
How many Hydrogen Bond Donor Count does Potassium 6-[methyl(phenylsulfonyl)amino]hexanoate have?
It has 0 Hydrogen Bond Donor Count.
What is the Topological Polar Surface Area of Potassium 6-[methyl(phenylsulfonyl)amino]hexanoate?
The Topological Polar Surface Area is 85.9 2.
Is the compound Canonicalized according to PubChem?
Yes, the compound is Canonicalized.
How many Component Compounds are there in Potassium 6-[methyl(phenylsulfonyl)amino]hexanoate?
There are two Component Compounds - CID 117892 and CID 5462222.