What is the molecular formula of Decahydro-2,4a,8a-trimethyl-1,6-methanonaphthalen-5-ol?
The molecular formula is C14H24O.
What is the molecular weight of Decahydro-2,4a,8a-trimethyl-1,6-methanonaphthalen-5-ol?
The molecular weight is 208.34 g/mol.
When was Decahydro-2,4a,8a-trimethyl-1,6-methanonaphthalen-5-ol first created?
It was first created on 2009-08-20.
What is the canonical SMILES representation of Decahydro-2,4a,8a-trimethyl-1,6-methanonaphthalen-5-ol?
The canonical SMILES is CC1CCC2(C(C3CCC2(C1C3)C)O)C.
How many hydrogen bond donor count does Decahydro-2,4a,8a-trimethyl-1,6-methanonaphthalen-5-ol have?
It has 1 hydrogen bond donor count.
What is the XLogP3-AA value of Decahydro-2,4a,8a-trimethyl-1,6-methanonaphthalen-5-ol?
The XLogP3-AA value is 3.7.
What is the InChIKey of Decahydro-2,4a,8a-trimethyl-1,6-methanonaphthalen-5-ol?
The InChIKey is BWHOSYVFAXOIRI-UHFFFAOYSA-N.
How many rotatable bond counts does Decahydro-2,4a,8a-trimethyl-1,6-methanonaphthalen-5-ol have?
It has 0 rotatable bond count.
What is the exact mass of Decahydro-2,4a,8a-trimethyl-1,6-methanonaphthalen-5-ol?
The exact mass is 208.182715385 g/mol.
Is Decahydro-2,4a,8a-trimethyl-1,6-methanonaphthalen-5-ol canonicalized?
Yes, it is canonicalized according to PubChem.